C11H17N3S — CID 127064169
1-butan-2-yl-3-(4-methyl-2-pyridinyl)thiourea (PubChem CID 127064169) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-butan-2-yl-3-(4-methyl-2-pyridinyl)thiourea.
| Compound Name | 1-butan-2-yl-3-(4-methyl-2-pyridinyl)thiourea |
|---|---|
| PubChem CID | 127064169 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-butan-2-yl-3-(4-methyl-2-pyridinyl)thiourea |
| SMILES | CCC(C)NC(=S)Nc1cc(C)ccn1 |
| InChI | InChI=1S/C11H17N3S/c1-4-9(3)13-11(15)14-10-7-8(2)5-6-12-10/h5-7,9H,4H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | TXBXYOBOSAYERB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|