C10H16N4S — CID 133203103
1-butan-2-yl-3-(4-methylpyrimidin-2-yl)thiourea (PubChem CID 133203103) has the molecular formula C10H16N4S and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-butan-2-yl-3-(4-methylpyrimidin-2-yl)thiourea.
| Compound Name | 1-butan-2-yl-3-(4-methylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 133203103 |
| Molecular Formula | C10H16N4S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-butan-2-yl-3-(4-methylpyrimidin-2-yl)thiourea |
| SMILES | CCC(C)NC(=S)Nc1nccc(C)n1 |
| InChI | InChI=1S/C10H16N4S/c1-4-7(2)13-10(15)14-9-11-6-5-8(3)12-9/h5-7H,4H2,1-3H3,(H2,11,12,13,14,15) |
| InChIKey | JQFMPORAZGLAOJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|