C16H20N4S — CID 100559549
1-(4-methylpyrimidin-2-yl)-3-[(2R)-4-phenylbutan-2-yl]thiourea (PubChem CID 100559549) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-(4-methylpyrimidin-2-yl)-3-[(2R)-4-phenylbutan-2-yl]thiourea.
| Compound Name | 1-(4-methylpyrimidin-2-yl)-3-[(2R)-4-phenylbutan-2-yl]thiourea |
|---|---|
| PubChem CID | 100559549 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-(4-methylpyrimidin-2-yl)-3-[(2R)-4-phenylbutan-2-yl]thiourea |
| SMILES | Cc1ccnc(NC(=S)N[C@H](C)CCc2ccccc2)n1 |
| InChI | InChI=1S/C16H20N4S/c1-12(8-9-14-6-4-3-5-7-14)19-16(21)20-15-17-11-10-13(2)18-15/h3-7,10-12H,8-9H2,1-2H3,(H2,17,18,19,20,21)/t12-/m1/s1 |
| InChIKey | BIQFHJRSQKPNQF-GFCCVEGCSA-N |
| XLogP | 3.09 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|