C19H20N4S2 — CID 100561998
1-[(2R)-4-phenylbutan-2-yl]-3-(4-thiophen-2-ylpyrimidin-2-yl)thiourea (PubChem CID 100561998) has the molecular formula C19H20N4S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-[(2R)-4-phenylbutan-2-yl]-3-(4-thiophen-2-ylpyrimidin-2-yl)thiourea.
| Compound Name | 1-[(2R)-4-phenylbutan-2-yl]-3-(4-thiophen-2-ylpyrimidin-2-yl)thiourea |
|---|---|
| PubChem CID | 100561998 |
| Molecular Formula | C19H20N4S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[(2R)-4-phenylbutan-2-yl]-3-(4-thiophen-2-ylpyrimidin-2-yl)thiourea |
| SMILES | C[C@H](CCc1ccccc1)NC(=S)Nc1nccc(-c2cccs2)n1 |
| InChI | InChI=1S/C19H20N4S2/c1-14(9-10-15-6-3-2-4-7-15)21-19(24)23-18-20-12-11-16(22-18)17-8-5-13-25-17/h2-8,11-14H,9-10H2,1H3,(H2,20,21,22,23,24)/t14-/m1/s1 |
| InChIKey | RVTOZJSERSTAOV-CQSZACIVSA-N |
| XLogP | 4.51 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|