C19H18N4O3S2 — CID 100569952
(3S)-3-(3-methoxyphenyl)-3-[(4-thiophen-2-ylpyrimidin-2-yl)carbamothioylamino]propanoic acid (PubChem CID 100569952) has the molecular formula C19H18N4O3S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is (3S)-3-(3-methoxyphenyl)-3-[(4-thiophen-2-ylpyrimidin-2-yl)carbamothioylamino]propanoic acid.
| Compound Name | (3S)-3-(3-methoxyphenyl)-3-[(4-thiophen-2-ylpyrimidin-2-yl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 100569952 |
| Molecular Formula | C19H18N4O3S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | (3S)-3-(3-methoxyphenyl)-3-[(4-thiophen-2-ylpyrimidin-2-yl)carbamothioylamino]propanoic acid |
| SMILES | COc1cccc([C@H](CC(=O)O)NC(=S)Nc2nccc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C19H18N4O3S2/c1-26-13-5-2-4-12(10-13)15(11-17(24)25)22-19(27)23-18-20-8-7-14(21-18)16-6-3-9-28-16/h2-10,15H,11H2,1H3,(H,24,25)(H2,20,21,22,23,27)/t15-/m0/s1 |
| InChIKey | SQYNHXSITROWLX-HNNXBMFYSA-N |
| XLogP | 3.72 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|