C22H20ClN3O3S2 — CID 100570419
(3S)-3-[[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]carbamothioylamino]-3-(3-methoxyphenyl)propanoic acid (PubChem CID 100570419) has the molecular formula C22H20ClN3O3S2 and a molecular weight of 474.01 g/mol. Its IUPAC name is (3S)-3-[[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]carbamothioylamino]-3-(3-methoxyphenyl)propanoic acid.
| Compound Name | (3S)-3-[[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]carbamothioylamino]-3-(3-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 100570419 |
| Molecular Formula | C22H20ClN3O3S2 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | (3S)-3-[[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]carbamothioylamino]-3-(3-methoxyphenyl)propanoic acid |
| SMILES | COc1cccc([C@H](CC(=O)O)NC(=S)Nc2cccnc2Sc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H20ClN3O3S2/c1-29-16-5-2-4-14(12-16)19(13-20(27)28)26-22(30)25-18-6-3-11-24-21(18)31-17-9-7-15(23)8-10-17/h2-12,19H,13H2,1H3,(H,27,28)(H2,25,26,30)/t19-/m0/s1 |
| InChIKey | LRTPPIHUESLXOX-IBGZPJMESA-N |
| XLogP | 5.40 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|