C25H24ClN5S2 — CID 100570355
1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]thiourea (PubChem CID 100570355) has the molecular formula C25H24ClN5S2 and a molecular weight of 494.09 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]thiourea |
|---|---|
| PubChem CID | 100570355 |
| Molecular Formula | C25H24ClN5S2 |
| Molecular Weight | 494.09 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-[2-[(2,6-dimethylquinolin-4-yl)amino]ethyl]thiourea |
| SMILES | Cc1ccc2nc(C)cc(NCCNC(=S)Nc3cccnc3Sc3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C25H24ClN5S2/c1-16-5-10-21-20(14-16)23(15-17(2)30-21)27-12-13-29-25(32)31-22-4-3-11-28-24(22)33-19-8-6-18(26)7-9-19/h3-11,14-15H,12-13H2,1-2H3,(H,27,30)(H2,29,31,32) |
| InChIKey | WLXBMLLZFWVWJP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.09 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|