C15H14ClN3S2 — CID 100562867
1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-prop-2-enylthiourea (PubChem CID 100562867) has the molecular formula C15H14ClN3S2 and a molecular weight of 335.89 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 100562867 |
| Molecular Formula | C15H14ClN3S2 |
| Molecular Weight | 335.89 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1cccnc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClN3S2/c1-2-9-18-15(20)19-13-4-3-10-17-14(13)21-12-7-5-11(16)6-8-12/h2-8,10H,1,9H2,(H2,18,19,20) |
| InChIKey | BFXUEHIMCQHABQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.89 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|