C23H19Cl2N5S2 — CID 100570329
1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-[2-[(7-chloroquinolin-4-yl)amino]ethyl]thiourea (PubChem CID 100570329) has the molecular formula C23H19Cl2N5S2 and a molecular weight of 500.48 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-[2-[(7-chloroquinolin-4-yl)amino]ethyl]thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-[2-[(7-chloroquinolin-4-yl)amino]ethyl]thiourea |
|---|---|
| PubChem CID | 100570329 |
| Molecular Formula | C23H19Cl2N5S2 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanyl-3-pyridinyl]-3-[2-[(7-chloroquinolin-4-yl)amino]ethyl]thiourea |
| SMILES | S=C(NCCNc1ccnc2cc(Cl)ccc12)Nc1cccnc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19Cl2N5S2/c24-15-3-6-17(7-4-15)32-22-20(2-1-10-28-22)30-23(31)29-13-12-27-19-9-11-26-21-14-16(25)5-8-18(19)21/h1-11,14H,12-13H2,(H,26,27)(H2,29,30,31) |
| InChIKey | OXZQIOHKQAVXIE-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|