C20H20BrClN4S — CID 100570576
1-(4-bromo-2,6-dimethylphenyl)-3-[2-[(7-chloroquinolin-4-yl)amino]ethyl]thiourea (PubChem CID 100570576) has the molecular formula C20H20BrClN4S and a molecular weight of 463.83 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)-3-[2-[(7-chloroquinolin-4-yl)amino]ethyl]thiourea.
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)-3-[2-[(7-chloroquinolin-4-yl)amino]ethyl]thiourea |
|---|---|
| PubChem CID | 100570576 |
| Molecular Formula | C20H20BrClN4S |
| Molecular Weight | 463.83 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)-3-[2-[(7-chloroquinolin-4-yl)amino]ethyl]thiourea |
| SMILES | Cc1cc(Br)cc(C)c1NC(=S)NCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H20BrClN4S/c1-12-9-14(21)10-13(2)19(12)26-20(27)25-8-7-24-17-5-6-23-18-11-15(22)3-4-16(17)18/h3-6,9-11H,7-8H2,1-2H3,(H,23,24)(H2,25,26,27) |
| InChIKey | RPLAOPPKQDRGMN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.83 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|