C27H26BrClN4O3S — CID 100793127
2-[(4-bromophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide (PubChem CID 100793127) has the molecular formula C27H26BrClN4O3S and a molecular weight of 601.95 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 100793127 |
| Molecular Formula | C27H26BrClN4O3S |
| Molecular Weight | 601.95 g/mol |
| Exact Mass | 600.06 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-(4-methylphenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCNc2ccnc3cc(Cl)ccc23)Cc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C27H26BrClN4O3S/c1-19-2-9-23(10-3-19)37(35,36)33(17-20-4-6-21(28)7-5-20)18-27(34)32-15-14-31-25-12-13-30-26-16-22(29)8-11-24(25)26/h2-13,16H,14-15,17-18H2,1H3,(H,30,31)(H,32,34) |
| InChIKey | HZJLFOZFXHKGEL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|