C26H23Cl3N4O3S — CID 100792319
2-[(4-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide (PubChem CID 100792319) has the molecular formula C26H23Cl3N4O3S and a molecular weight of 577.92 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 100792319 |
| Molecular Formula | C26H23Cl3N4O3S |
| Molecular Weight | 577.92 g/mol |
| Exact Mass | 576.06 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(4-chlorophenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)cc1)NCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H23Cl3N4O3S/c27-19-3-1-18(2-4-19)16-33(37(35,36)22-8-5-20(28)6-9-22)17-26(34)32-14-13-31-24-11-12-30-25-15-21(29)7-10-23(24)25/h1-12,15H,13-14,16-17H2,(H,30,31)(H,32,34) |
| InChIKey | UNIDJSAMSCWGNW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.92 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|