C26H24BrClN4O3S — CID 100790652
2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide (PubChem CID 100790652) has the molecular formula C26H24BrClN4O3S and a molecular weight of 587.93 g/mol. Its IUPAC name is 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 100790652 |
| Molecular Formula | C26H24BrClN4O3S |
| Molecular Weight | 587.93 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | 2-[benzyl-(4-bromophenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccc(Br)cc1)NCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H24BrClN4O3S/c27-20-6-9-22(10-7-20)36(34,35)32(17-19-4-2-1-3-5-19)18-26(33)31-15-14-30-24-12-13-29-25-16-21(28)8-11-23(24)25/h1-13,16H,14-15,17-18H2,(H,29,30)(H,31,33) |
| InChIKey | CGKOXJXYZANAPH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|