C30H33ClN4O5S — CID 100791462
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide (PubChem CID 100791462) has the molecular formula C30H33ClN4O5S and a molecular weight of 597.14 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 100791462 |
| Molecular Formula | C30H33ClN4O5S |
| Molecular Weight | 597.14 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-[(3,4-dimethoxyphenyl)sulfonyl-(2-phenylethyl)amino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCc2ccccc2)CC(=O)NCCCNc2ccnc3cc(Cl)ccc23)cc1OC |
| InChI | InChI=1S/C30H33ClN4O5S/c1-39-28-12-10-24(20-29(28)40-2)41(37,38)35(18-14-22-7-4-3-5-8-22)21-30(36)34-16-6-15-32-26-13-17-33-27-19-23(31)9-11-25(26)27/h3-5,7-13,17,19-20H,6,14-16,18,21H2,1-2H3,(H,32,33)(H,34,36) |
| InChIKey | XYRYAGOWVYKLDO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.14 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|