C28H29ClN4O4S — CID 100796036
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-(N-(2-methoxy-5-methylphenyl)sulfonylanilino)acetamide (PubChem CID 100796036) has the molecular formula C28H29ClN4O4S and a molecular weight of 553.08 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-(N-(2-methoxy-5-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-(N-(2-methoxy-5-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 100796036 |
| Molecular Formula | C28H29ClN4O4S |
| Molecular Weight | 553.08 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-(N-(2-methoxy-5-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)NCCCNc1ccnc2cc(Cl)ccc12)c1ccccc1 |
| InChI | InChI=1S/C28H29ClN4O4S/c1-20-9-12-26(37-2)27(17-20)38(35,36)33(22-7-4-3-5-8-22)19-28(34)32-15-6-14-30-24-13-16-31-25-18-21(29)10-11-23(24)25/h3-5,7-13,16-18H,6,14-15,19H2,1-2H3,(H,30,31)(H,32,34) |
| InChIKey | YZZSYKLTQINKAN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.08 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|