C30H32Cl2N4O3S — CID 100795332
2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]acetamide (PubChem CID 100795332) has the molecular formula C30H32Cl2N4O3S and a molecular weight of 599.58 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 100795332 |
| Molecular Formula | C30H32Cl2N4O3S |
| Molecular Weight | 599.58 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CC(=O)NCCCNc2ccnc3cc(Cl)ccc23)Cc2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C30H32Cl2N4O3S/c1-20-15-21(2)30(22(3)16-20)40(38,39)36(18-23-5-7-24(31)8-6-23)19-29(37)35-13-4-12-33-27-11-14-34-28-17-25(32)9-10-26(27)28/h5-11,14-17H,4,12-13,18-19H2,1-3H3,(H,33,34)(H,35,37) |
| InChIKey | HRYAZGFCUQAUBD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.58 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|