C29H31ClN4O4S — CID 100797360
2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide (PubChem CID 100797360) has the molecular formula C29H31ClN4O4S and a molecular weight of 567.11 g/mol. Its IUPAC name is 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 100797360 |
| Molecular Formula | C29H31ClN4O4S |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[benzyl-(4-ethoxy-3-methylphenyl)sulfonylamino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)NCCNc2ccnc3cc(Cl)ccc23)Cc2ccccc2)cc1C |
| InChI | InChI=1S/C29H31ClN4O4S/c1-3-38-28-12-10-24(17-21(28)2)39(36,37)34(19-22-7-5-4-6-8-22)20-29(35)33-16-15-32-26-13-14-31-27-18-23(30)9-11-25(26)27/h4-14,17-18H,3,15-16,19-20H2,1-2H3,(H,31,32)(H,33,35) |
| InChIKey | ZPNQEAVXKVCMOC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|