C26H22Cl4N4O3S — CID 100790561
2-[(4-chlorophenyl)sulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide (PubChem CID 100790561) has the molecular formula C26H22Cl4N4O3S and a molecular weight of 612.37 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 100790561 |
| Molecular Formula | C26H22Cl4N4O3S |
| Molecular Weight | 612.37 g/mol |
| Exact Mass | 610.02 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-[(3,4-dichlorophenyl)methyl]amino]-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccc(Cl)cc1)NCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H22Cl4N4O3S/c27-18-2-5-20(6-3-18)38(36,37)34(15-17-1-8-22(29)23(30)13-17)16-26(35)33-12-11-32-24-9-10-31-25-14-19(28)4-7-21(24)25/h1-10,13-14H,11-12,15-16H2,(H,31,32)(H,33,35) |
| InChIKey | RASIZWIHNSSRQS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.37 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|