C24H29ClN4O4S — CID 100798529
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-[ethyl-(4-methoxy-3-methylphenyl)sulfonylamino]acetamide (PubChem CID 100798529) has the molecular formula C24H29ClN4O4S and a molecular weight of 505.04 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-[ethyl-(4-methoxy-3-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-[ethyl-(4-methoxy-3-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 100798529 |
| Molecular Formula | C24H29ClN4O4S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-[ethyl-(4-methoxy-3-methylphenyl)sulfonylamino]acetamide |
| SMILES | CCN(CC(=O)NCCCNc1ccnc2cc(Cl)ccc12)S(=O)(=O)c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C24H29ClN4O4S/c1-4-29(34(31,32)19-7-9-23(33-3)17(2)14-19)16-24(30)28-12-5-11-26-21-10-13-27-22-15-18(25)6-8-20(21)22/h6-10,13-15H,4-5,11-12,16H2,1-3H3,(H,26,27)(H,28,30) |
| InChIKey | IAGFNKHMEZBKCE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|