C22H30N2O5S — CID 126390865
2-(N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 126390865) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is 2-(N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-(N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 126390865 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-(N-(2-methoxy-5-methylphenyl)sulfonylanilino)-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)NCCCOC(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H30N2O5S/c1-17(2)29-14-8-13-23-22(25)16-24(19-9-6-5-7-10-19)30(26,27)21-15-18(3)11-12-20(21)28-4/h5-7,9-12,15,17H,8,13-14,16H2,1-4H3,(H,23,25) |
| InChIKey | DUJPVVXIQLFXRN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|