C16H27N3O4S — CID 17200342
2-[N-(dimethylsulfamoyl)anilino]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 17200342) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)anilino]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[N-(dimethylsulfamoyl)anilino]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 17200342 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)anilino]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)CN(c1ccccc1)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C16H27N3O4S/c1-14(2)23-12-8-11-17-16(20)13-19(24(21,22)18(3)4)15-9-6-5-7-10-15/h5-7,9-10,14H,8,11-13H2,1-4H3,(H,17,20) |
| InChIKey | URDCORQKCKZJGG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|