C23H32N2O6S — CID 3655760
2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 3655760) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 3655760 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(CC(=O)NCCCOC(C)C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H32N2O6S/c1-18(2)31-14-8-13-24-23(26)17-25(16-19-9-6-5-7-10-19)32(27,28)22-15-20(29-3)11-12-21(22)30-4/h5-7,9-12,15,18H,8,13-14,16-17H2,1-4H3,(H,24,26) |
| InChIKey | NTBHBICSQRAOFL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|