C25H25N3O7S — CID 126373097
2-[(E)-[[2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 126373097) has the molecular formula C25H25N3O7S and a molecular weight of 511.56 g/mol. Its IUPAC name is 2-[(E)-[[2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[(E)-[[2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 126373097 |
| Molecular Formula | C25H25N3O7S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 2-[(E)-[[2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(CC(=O)N/N=C/c2ccccc2C(=O)O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H25N3O7S/c1-34-20-12-13-22(35-2)23(14-20)36(32,33)28(16-18-8-4-3-5-9-18)17-24(29)27-26-15-19-10-6-7-11-21(19)25(30)31/h3-15H,16-17H2,1-2H3,(H,27,29)(H,30,31)/b26-15+ |
| InChIKey | WNJBNHSBEBEDOV-CVKSISIWSA-N |
| XLogP | 2.74 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|