C25H25N3O6S — CID 3985642
2-[[[2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 3985642) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is 2-[[[2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[[[2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 3985642 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-[[[2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)NN=Cc1ccccc1C(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C25H25N3O6S/c1-18-12-13-22(34-2)23(14-18)35(32,33)28(16-19-8-4-3-5-9-19)17-24(29)27-26-15-20-10-6-7-11-21(20)25(30)31/h3-15H,16-17H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | JQAXHHLLZAKKRS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|