C26H29N3O6S — CID 126372784
2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 126372784) has the molecular formula C26H29N3O6S and a molecular weight of 511.60 g/mol. Its IUPAC name is 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126372784 |
| Molecular Formula | C26H29N3O6S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)CN(Cc2ccccc2)S(=O)(=O)c2cc(C)ccc2OC)c(OC)c1 |
| InChI | InChI=1S/C26H29N3O6S/c1-19-10-13-23(34-3)25(14-19)36(31,32)29(17-20-8-6-5-7-9-20)18-26(30)28-27-16-21-11-12-22(33-2)15-24(21)35-4/h5-16H,17-18H2,1-4H3,(H,28,30)/b27-16+ |
| InChIKey | TZRMAEMJZDGRPY-JVWAILMASA-N |
| XLogP | 3.36 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|