C23H24N4O4S — CID 124550664
2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-pyridin-2-ylmethylideneamino]acetamide (PubChem CID 124550664) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-pyridin-2-ylmethylideneamino]acetamide.
| Compound Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-pyridin-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 124550664 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-pyridin-2-ylmethylideneamino]acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)N/N=C/c1ccccn1)Cc1ccccc1 |
| InChI | InChI=1S/C23H24N4O4S/c1-18-11-12-21(31-2)22(14-18)32(29,30)27(16-19-8-4-3-5-9-19)17-23(28)26-25-15-20-10-6-7-13-24-20/h3-15H,16-17H2,1-2H3,(H,26,28)/b25-15+ |
| InChIKey | FUXDAWQWMUZTPF-MFKUBSTISA-N |
| XLogP | 2.74 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|