C21H28N2O5S — CID 4693114
2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-butan-2-ylacetamide (PubChem CID 4693114) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-butan-2-ylacetamide.
| Compound Name | 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-butan-2-ylacetamide |
|---|---|
| PubChem CID | 4693114 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-butan-2-ylacetamide |
| SMILES | CCC(C)NC(=O)CN(Cc1ccccc1)S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C21H28N2O5S/c1-5-16(2)22-21(24)15-23(14-17-9-7-6-8-10-17)29(25,26)20-13-18(27-3)11-12-19(20)28-4/h6-13,16H,5,14-15H2,1-4H3,(H,22,24) |
| InChIKey | VMAWQLHADFHLPQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |