C26H31ClN4O5S — CID 125048226
(3S)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 125048226) has the molecular formula C26H31ClN4O5S and a molecular weight of 547.08 g/mol. Its IUPAC name is (3S)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125048226 |
| Molecular Formula | C26H31ClN4O5S |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | (3S)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)NCCCNc3ccnc4cc(Cl)ccc34)C2)cc1OC |
| InChI | InChI=1S/C26H31ClN4O5S/c1-35-24-9-7-20(16-25(24)36-2)37(33,34)31-14-3-5-18(17-31)26(32)30-12-4-11-28-22-10-13-29-23-15-19(27)6-8-21(22)23/h6-10,13,15-16,18H,3-5,11-12,14,17H2,1-2H3,(H,28,29)(H,30,32)/t18-/m0/s1 |
| InChIKey | JEOLDSWGQQOVGC-SFHVURJKSA-N |
| XLogP | 3.92 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|