C26H31ClN4O3S — CID 100779895
(3R)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 100779895) has the molecular formula C26H31ClN4O3S and a molecular weight of 515.08 g/mol. Its IUPAC name is (3R)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 100779895 |
| Molecular Formula | C26H31ClN4O3S |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (3R)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC[C@@H](C(=O)NCCCNc3ccnc4cc(Cl)ccc34)C2)c1 |
| InChI | InChI=1S/C26H31ClN4O3S/c1-18-6-7-19(2)25(15-18)35(33,34)31-14-3-5-20(17-31)26(32)30-12-4-11-28-23-10-13-29-24-16-21(27)8-9-22(23)24/h6-10,13,15-16,20H,3-5,11-12,14,17H2,1-2H3,(H,28,29)(H,30,32)/t20-/m1/s1 |
| InChIKey | YAXKZOLKNPVKFE-HXUWFJFHSA-N |
| XLogP | 4.52 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|