C25H29ClN4O — CID 133159185
1-benzyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide (PubChem CID 133159185) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 1-benzyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133159185 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-benzyl-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCNc1ccnc2cc(Cl)ccc12)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C25H29ClN4O/c26-21-9-10-22-23(11-14-28-24(22)16-21)27-12-5-13-29-25(31)20-8-4-15-30(18-20)17-19-6-2-1-3-7-19/h1-3,6-7,9-11,14,16,20H,4-5,8,12-13,15,17-18H2,(H,27,28)(H,29,31) |
| InChIKey | BMVHSNLKXVZXQP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|