C19H25ClN4O3S — CID 125047802
(3S)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 125047802) has the molecular formula C19H25ClN4O3S and a molecular weight of 424.95 g/mol. Its IUPAC name is (3S)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125047802 |
| Molecular Formula | C19H25ClN4O3S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (3S)-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CCC[C@H](C(=O)NCCCNc2ccnc3cc(Cl)ccc23)C1 |
| InChI | InChI=1S/C19H25ClN4O3S/c1-28(26,27)24-11-2-4-14(13-24)19(25)23-9-3-8-21-17-7-10-22-18-12-15(20)5-6-16(17)18/h5-7,10,12,14H,2-4,8-9,11,13H2,1H3,(H,21,22)(H,23,25)/t14-/m0/s1 |
| InChIKey | FHYZQRGURAVGEW-AWEZNQCLSA-N |
| XLogP | 2.48 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|