C25H28Cl2N4O — CID 100777789
(3R)-1-[(4-chlorophenyl)methyl]-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide (PubChem CID 100777789) has the molecular formula C25H28Cl2N4O and a molecular weight of 471.43 g/mol. Its IUPAC name is (3R)-1-[(4-chlorophenyl)methyl]-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[(4-chlorophenyl)methyl]-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 100777789 |
| Molecular Formula | C25H28Cl2N4O |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (3R)-1-[(4-chlorophenyl)methyl]-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCNc1ccnc2cc(Cl)ccc12)[C@@H]1CCCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H28Cl2N4O/c26-20-6-4-18(5-7-20)16-31-14-1-3-19(17-31)25(32)30-12-2-11-28-23-10-13-29-24-15-21(27)8-9-22(23)24/h4-10,13,15,19H,1-3,11-12,14,16-17H2,(H,28,29)(H,30,32)/t19-/m1/s1 |
| InChIKey | BPQFDDWOHNRUGN-LJQANCHMSA-N |
| XLogP | 5.37 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|