C18H24ClN3 — CID 132819923
N-[3-(azepan-1-yl)propyl]-7-chloroquinolin-4-amine (PubChem CID 132819923) has the molecular formula C18H24ClN3 and a molecular weight of 317.86 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-7-chloroquinolin-4-amine.
| Compound Name | N-[3-(azepan-1-yl)propyl]-7-chloroquinolin-4-amine |
|---|---|
| PubChem CID | 132819923 |
| Molecular Formula | C18H24ClN3 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-7-chloroquinolin-4-amine |
| SMILES | Clc1ccc2c(NCCCN3CCCCCC3)ccnc2c1 |
| InChI | InChI=1S/C18H24ClN3/c19-15-6-7-16-17(8-10-21-18(16)14-15)20-9-5-13-22-11-3-1-2-4-12-22/h6-8,10,14H,1-5,9,11-13H2,(H,20,21) |
| InChIKey | OSKSKBHBBGJETN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|