C23H30ClN3O3 — CID 42629269
7-chloro-N-[3-(7,14,15-trioxa-11-azadispiro[4.2.58.25]pentadecan-11-yl)propyl]quinolin-4-amine (PubChem CID 42629269) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is 7-chloro-N-[3-(7,14,15-trioxa-11-azadispiro[4.2.58.25]pentadecan-11-yl)propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-(7,14,15-trioxa-11-azadispiro[4.2.58.25]pentadecan-11-yl)propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 42629269 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 7-chloro-N-[3-(7,14,15-trioxa-11-azadispiro[4.2.58.25]pentadecan-11-yl)propyl]quinolin-4-amine |
| SMILES | Clc1ccc2c(NCCCN3CCC4(CC3)OCC3(CCCC3)OO4)ccnc2c1 |
| InChI | InChI=1S/C23H30ClN3O3/c24-18-4-5-19-20(6-12-26-21(19)16-18)25-11-3-13-27-14-9-23(10-15-27)28-17-22(29-30-23)7-1-2-8-22/h4-6,12,16H,1-3,7-11,13-15,17H2,(H,25,26) |
| InChIKey | FVMDTGVCZYCOCL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|