C21H28ClN3O3 — CID 88938776
7-chloro-N-[3-(3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecan-9-yl)propyl]quinolin-4-amine (PubChem CID 88938776) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is 7-chloro-N-[3-(3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecan-9-yl)propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-(3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecan-9-yl)propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 88938776 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 7-chloro-N-[3-(3,3-dimethyl-1,2,5-trioxa-9-azaspiro[5.5]undecan-9-yl)propyl]quinolin-4-amine |
| SMILES | CC1(C)COC2(CCN(CCCNc3ccnc4cc(Cl)ccc34)CC2)OO1 |
| InChI | InChI=1S/C21H28ClN3O3/c1-20(2)15-26-21(28-27-20)7-12-25(13-8-21)11-3-9-23-18-6-10-24-19-14-16(22)4-5-17(18)19/h4-6,10,14H,3,7-9,11-13,15H2,1-2H3,(H,23,24) |
| InChIKey | BBTLCKZHDHHBAV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|