C25H34ClN3O3 — CID 24864362
4-N-(7-chloroquinolin-4-yl)-1-N-(3,3-dimethyl-1,2,5-trioxaspiro[5.5]undecan-9-yl)cyclohexane-1,4-diamine (PubChem CID 24864362) has the molecular formula C25H34ClN3O3 and a molecular weight of 460.02 g/mol. Its IUPAC name is 4-N-(7-chloroquinolin-4-yl)-1-N-(3,3-dimethyl-1,2,5-trioxaspiro[5.5]undecan-9-yl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(7-chloroquinolin-4-yl)-1-N-(3,3-dimethyl-1,2,5-trioxaspiro[5.5]undecan-9-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 24864362 |
| Molecular Formula | C25H34ClN3O3 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N-(3,3-dimethyl-1,2,5-trioxaspiro[5.5]undecan-9-yl)cyclohexane-1,4-diamine |
| SMILES | CC1(C)COC2(CCC(NC3CCC(Nc4ccnc5cc(Cl)ccc45)CC3)CC2)OO1 |
| InChI | InChI=1S/C25H34ClN3O3/c1-24(2)16-30-25(32-31-24)12-9-20(10-13-25)28-18-4-6-19(7-5-18)29-22-11-14-27-23-15-17(26)3-8-21(22)23/h3,8,11,14-15,18-20,28H,4-7,9-10,12-13,16H2,1-2H3,(H,27,29) |
| InChIKey | TZTRMWSUUKFQAY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|