C21H20Cl2N4O — CID 22641834
2-chloro-N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]pyridine-4-carboxamide (PubChem CID 22641834) has the molecular formula C21H20Cl2N4O and a molecular weight of 415.32 g/mol. Its IUPAC name is 2-chloro-N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 22641834 |
| Molecular Formula | C21H20Cl2N4O |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-chloro-N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]pyridine-4-carboxamide |
| SMILES | O=C(NC1CCC(Nc2ccnc3cc(Cl)ccc23)CC1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C21H20Cl2N4O/c22-14-1-6-17-18(8-10-24-19(17)12-14)26-15-2-4-16(5-3-15)27-21(28)13-7-9-25-20(23)11-13/h1,6-12,15-16H,2-5H2,(H,24,26)(H,27,28) |
| InChIKey | POCOMDVKUADDNI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|