C24H26ClN3O — CID 10287647
N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3,4-dimethylbenzamide (PubChem CID 10287647) has the molecular formula C24H26ClN3O and a molecular weight of 407.95 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3,4-dimethylbenzamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 10287647 |
| Molecular Formula | C24H26ClN3O |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCC(Nc3ccnc4cc(Cl)ccc34)CC2)cc1C |
| InChI | InChI=1S/C24H26ClN3O/c1-15-3-4-17(13-16(15)2)24(29)28-20-8-6-19(7-9-20)27-22-11-12-26-23-14-18(25)5-10-21(22)23/h3-5,10-14,19-20H,6-9H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | GFKDJPLXTXDPQN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |