C24H22ClN5O — CID 22641879
N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]quinoxaline-2-carboxamide (PubChem CID 22641879) has the molecular formula C24H22ClN5O and a molecular weight of 431.93 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]quinoxaline-2-carboxamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 22641879 |
| Molecular Formula | C24H22ClN5O |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]quinoxaline-2-carboxamide |
| SMILES | O=C(NC1CCC(Nc2ccnc3cc(Cl)ccc23)CC1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C24H22ClN5O/c25-15-5-10-18-19(11-12-26-22(18)13-15)28-16-6-8-17(9-7-16)29-24(31)23-14-27-20-3-1-2-4-21(20)30-23/h1-5,10-14,16-17H,6-9H2,(H,26,28)(H,29,31) |
| InChIKey | AKTKXTDYVCOLAH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |