C30H27ClFN3O — CID 22641736
N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3-fluoro-5-[(E)-2-phenylethenyl]benzamide (PubChem CID 22641736) has the molecular formula C30H27ClFN3O and a molecular weight of 500.02 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3-fluoro-5-[(E)-2-phenylethenyl]benzamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3-fluoro-5-[(E)-2-phenylethenyl]benzamide |
|---|---|
| PubChem CID | 22641736 |
| Molecular Formula | C30H27ClFN3O |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3-fluoro-5-[(E)-2-phenylethenyl]benzamide |
| SMILES | O=C(NC1CCC(Nc2ccnc3cc(Cl)ccc23)CC1)c1cc(F)cc(/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C30H27ClFN3O/c31-23-8-13-27-28(14-15-33-29(27)19-23)34-25-9-11-26(12-10-25)35-30(36)22-16-21(17-24(32)18-22)7-6-20-4-2-1-3-5-20/h1-8,13-19,25-26H,9-12H2,(H,33,34)(H,35,36)/b7-6+ |
| InChIKey | IHVGQFFERORYJT-VOTSOKGWSA-N |
| XLogP | 7.35 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|