C23H22ClN3O3 — CID 10238056
N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 10238056) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 10238056 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC1CCC(Nc2ccnc3cc(Cl)ccc23)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H22ClN3O3/c24-15-2-7-18-19(9-10-25-20(18)12-15)26-16-3-5-17(6-4-16)27-23(28)14-1-8-21-22(11-14)30-13-29-21/h1-2,7-12,16-17H,3-6,13H2,(H,25,26)(H,27,28) |
| InChIKey | QAXXYAPJTWRJSH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |