C19H19ClN4OS — CID 10045727
N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-1,3-thiazole-2-carboxamide (PubChem CID 10045727) has the molecular formula C19H19ClN4OS and a molecular weight of 386.91 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 10045727 |
| Molecular Formula | C19H19ClN4OS |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NC1CCC(Nc2ccnc3cc(Cl)ccc23)CC1)c1nccs1 |
| InChI | InChI=1S/C19H19ClN4OS/c20-12-1-6-15-16(7-8-21-17(15)11-12)23-13-2-4-14(5-3-13)24-18(25)19-22-9-10-26-19/h1,6-11,13-14H,2-5H2,(H,21,23)(H,24,25) |
| InChIKey | QKDTWAAFAKNIBL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |