C23H24ClN3O2 — CID 22641827
N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-2-hydroxy-5-methylbenzamide (PubChem CID 22641827) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-2-hydroxy-5-methylbenzamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 22641827 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)NC2CCC(Nc3ccnc4cc(Cl)ccc34)CC2)c1 |
| InChI | InChI=1S/C23H24ClN3O2/c1-14-2-9-22(28)19(12-14)23(29)27-17-6-4-16(5-7-17)26-20-10-11-25-21-13-15(24)3-8-18(20)21/h2-3,8-13,16-17,28H,4-7H2,1H3,(H,25,26)(H,27,29) |
| InChIKey | RARHBFRZHJGMGM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |