C13H14ClN3 — CID 67618697
7-chloro-N-[(3R)-pyrrolidin-3-yl]quinolin-4-amine (PubChem CID 67618697) has the molecular formula C13H14ClN3 and a molecular weight of 247.73 g/mol. Its IUPAC name is 7-chloro-N-[(3R)-pyrrolidin-3-yl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[(3R)-pyrrolidin-3-yl]quinolin-4-amine |
|---|---|
| PubChem CID | 67618697 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 7-chloro-N-[(3R)-pyrrolidin-3-yl]quinolin-4-amine |
| SMILES | Clc1ccc2c(N[C@@H]3CCNC3)ccnc2c1 |
| InChI | InChI=1S/C13H14ClN3/c14-9-1-2-11-12(4-6-16-13(11)7-9)17-10-3-5-15-8-10/h1-2,4,6-7,10,15H,3,5,8H2,(H,16,17)/t10-/m1/s1 |
| InChIKey | SIKREZNZCUOCOS-SNVBAGLBSA-N |
| XLogP | 2.66 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |