C22H20Cl2N6 — CID 591300
1-N,4-N-bis(7-chloroquinolin-4-yl)piperazine-1,4-diamine (PubChem CID 591300) has the molecular formula C22H20Cl2N6 and a molecular weight of 439.35 g/mol. Its IUPAC name is 1-N,4-N-bis(7-chloroquinolin-4-yl)piperazine-1,4-diamine.
| Compound Name | 1-N,4-N-bis(7-chloroquinolin-4-yl)piperazine-1,4-diamine |
|---|---|
| PubChem CID | 591300 |
| Molecular Formula | C22H20Cl2N6 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-N,4-N-bis(7-chloroquinolin-4-yl)piperazine-1,4-diamine |
| SMILES | Clc1ccc2c(NN3CCN(Nc4ccnc5cc(Cl)ccc45)CC3)ccnc2c1 |
| InChI | InChI=1S/C22H20Cl2N6/c23-15-1-3-17-19(5-7-25-21(17)13-15)27-29-9-11-30(12-10-29)28-20-6-8-26-22-14-16(24)2-4-18(20)22/h1-8,13-14H,9-12H2,(H,25,27)(H,26,28) |
| InChIKey | OELIZBOAPNQQAI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |