C20H21Cl2N4+ — CID 7256421
7-chloro-N-[3-chloro-4-(4-methylpiperazin-4-ium-1-yl)phenyl]quinolin-4-amine (PubChem CID 7256421) has the molecular formula C20H21Cl2N4+ and a molecular weight of 388.32 g/mol. Its IUPAC name is 7-chloro-N-[3-chloro-4-(4-methylpiperazin-4-ium-1-yl)phenyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-chloro-4-(4-methylpiperazin-4-ium-1-yl)phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 7256421 |
| Molecular Formula | C20H21Cl2N4+ |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 7-chloro-N-[3-chloro-4-(4-methylpiperazin-4-ium-1-yl)phenyl]quinolin-4-amine |
| SMILES | C[NH+]1CCN(c2ccc(Nc3ccnc4cc(Cl)ccc34)cc2Cl)CC1 |
| InChI | InChI=1S/C20H20Cl2N4/c1-25-8-10-26(11-9-25)20-5-3-15(13-17(20)22)24-18-6-7-23-19-12-14(21)2-4-16(18)19/h2-7,12-13H,8-11H2,1H3,(H,23,24)/p+1 |
| InChIKey | MUIDVQFFIMNAMA-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 32.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|