C20H21Cl2N3O2 — CID 67247174
[5-[(7-chloroquinolin-4-yl)amino]-2-morpholin-4-ylphenyl]methanol;hydrochloride (PubChem CID 67247174) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is [5-[(7-chloroquinolin-4-yl)amino]-2-morpholin-4-ylphenyl]methanol;hydrochloride.
| Compound Name | [5-[(7-chloroquinolin-4-yl)amino]-2-morpholin-4-ylphenyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 67247174 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [5-[(7-chloroquinolin-4-yl)amino]-2-morpholin-4-ylphenyl]methanol;hydrochloride |
| SMILES | Cl.OCc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H20ClN3O2.ClH/c21-15-1-3-17-18(5-6-22-19(17)12-15)23-16-2-4-20(14(11-16)13-25)24-7-9-26-10-8-24;/h1-6,11-12,25H,7-10,13H2,(H,22,23);1H |
| InChIKey | SMCIUFVTNPDHJA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|