C12H16ClNO2 — CID 114845567
[5-chloro-2-(1,4-oxazepan-4-yl)phenyl]methanol (PubChem CID 114845567) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is [5-chloro-2-(1,4-oxazepan-4-yl)phenyl]methanol.
| Compound Name | [5-chloro-2-(1,4-oxazepan-4-yl)phenyl]methanol |
|---|---|
| PubChem CID | 114845567 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | [5-chloro-2-(1,4-oxazepan-4-yl)phenyl]methanol |
| SMILES | OCc1cc(Cl)ccc1N1CCCOCC1 |
| InChI | InChI=1S/C12H16ClNO2/c13-11-2-3-12(10(8-11)9-15)14-4-1-6-16-7-5-14/h2-3,8,15H,1,4-7,9H2 |
| InChIKey | RQKTWHFOKLLIKL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |