C12H14ClNO2 — CID 114844265
4-chloro-2-(1,4-oxazepan-4-yl)benzaldehyde (PubChem CID 114844265) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is 4-chloro-2-(1,4-oxazepan-4-yl)benzaldehyde.
| Compound Name | 4-chloro-2-(1,4-oxazepan-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 114844265 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-chloro-2-(1,4-oxazepan-4-yl)benzaldehyde |
| SMILES | O=Cc1ccc(Cl)cc1N1CCCOCC1 |
| InChI | InChI=1S/C12H14ClNO2/c13-11-3-2-10(9-15)12(8-11)14-4-1-6-16-7-5-14/h2-3,8-9H,1,4-7H2 |
| InChIKey | RXIXCXSTUSWSKW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|