C14H20ClNO2 — CID 114218552
[5-chloro-2-(2-ethyl-1,4-oxazepan-4-yl)phenyl]methanol (PubChem CID 114218552) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is [5-chloro-2-(2-ethyl-1,4-oxazepan-4-yl)phenyl]methanol.
| Compound Name | [5-chloro-2-(2-ethyl-1,4-oxazepan-4-yl)phenyl]methanol |
|---|---|
| PubChem CID | 114218552 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [5-chloro-2-(2-ethyl-1,4-oxazepan-4-yl)phenyl]methanol |
| SMILES | CCC1CN(c2ccc(Cl)cc2CO)CCCO1 |
| InChI | InChI=1S/C14H20ClNO2/c1-2-13-9-16(6-3-7-18-13)14-5-4-12(15)8-11(14)10-17/h4-5,8,13,17H,2-3,6-7,9-10H2,1H3 |
| InChIKey | NBSKTOQUMFHFKT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |